methyl 10-undecenoate

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

10-hendecenoic acid methyl ester; methyl 10-hendecenoate; methyl 10-undecenoate; methyl undec-10-enoate; methyl undecylenate; methyl undecylenoate; 10-undecenoic acid methyl ester; undecylenic acid methyl ester
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS RN:[111-81-9]
Formula:C12H22O2; 198.31 g/mol
InChiKey:KISVAASFGZJBCY-UHFFFAOYSA-N
SMILES:COC(=O)CCCCCCCCC=C
Molecular structure of methyl 10-undecenoate
Density:0.886 g/mL
Molar volume:223.8 mL/mol
Refractive index:1.439
Molecular refractive power:58.84 mL/mol
Melting point:-28 °C
Boiling point:247 °C
Surface tension:30.06 dyn/cm

Isomers

arbanol
Molecular structure of arbanol
(bicyclohexyl)-1,1'-diol
Molecular structure of (bicyclohexyl)-1,1'-diol
trans-4-tert-butylcyclohexyl acetate
Molecular structure of trans-4-tert-butylcyclohexyl acetate
citral dimethyl acetal
Molecular structure of citral dimethyl acetal
citronellyl acetate
Molecular structure of citronellyl acetate
1-cyclohexylethyl butanoate
Molecular structure of 1-cyclohexylethyl butanoate
cyclohexyl hexanoate
Molecular structure of cyclohexyl hexanoate
1,1-diethoxy-2-octyne
Molecular structure of 1,1-diethoxy-2-octyne
4,7-dimethyldec-5-yne-4,7-diol
Molecular structure of 4,7-dimethyldec-5-yne-4,7-diol
cis-5-dodecenoic acid
Molecular structure of cis-5-dodecenoic acid
ethenyl 2,2-dimethyloctanoate
Molecular structure of ethenyl 2,2-dimethyloctanoate
ethyl trans-2-decenoate
Molecular structure of ethyl trans-2-decenoate
ethyl trans-4-decenoate
Molecular structure of ethyl trans-4-decenoate
2-ethylhexyl 2-methylpropenoate
Molecular structure of 2-ethylhexyl 2-methylpropenoate
6-heptyloxan-2-one
Molecular structure of 6-heptyloxan-2-one
2-hydroxycyclododecanone
Molecular structure of 2-hydroxycyclododecanone
3-(2-hydroxyethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol
Molecular structure of 3-(2-hydroxyethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol
(1S,2R,5S)-2-isopropyl-5-methylcyclohexyl acetate
Molecular structure of (1S,2R,5S)-2-isopropyl-5-methylcyclohexyl acetate
l-menthyl acetate
Molecular structure of l-menthyl acetate
menthyl acetate
Molecular structure of menthyl acetate
2-methyloctyl prop-2-enoate
Molecular structure of 2-methyloctyl prop-2-enoate
methyl 10-undecenoate
Molecular structure of methyl 10-undecenoate
1-octen-3-yl butyrate
Molecular structure of 1-octen-3-yl butyrate
5-octyloxolan-2-one
Molecular structure of 5-octyloxolan-2-one
oxacyclotridecan-2-one
Molecular structure of oxacyclotridecan-2-one
trans-4-n-pentylcyclohexanecarboxylic acid
Molecular structure of trans-4-n-pentylcyclohexanecarboxylic acid
trans-4-(propan-2-yl)cyclohexyl propanoate
Molecular structure of trans-4-(propan-2-yl)cyclohexyl propanoate
1,1,5-trimethylhept-6-en-1-yl acetate
Molecular structure of 1,1,5-trimethylhept-6-en-1-yl acetate
vinyl decanoate
Molecular structure of vinyl decanoate
  ::